Oxacyclic compounds
Chem-Impex International, Inc. Oxazole-4-carboxylic acid ethyl ester | 23012-14-8 | MFCD04114940 | 10G
Oxazole-4-carboxylic acid ethyl ester, 23012-14-8, MFCD04114940, 10G
eMolecules 855948-13-9 | 2-(2-Furyl)aniline hydrochloride | Combi-Blocks | MFCD08445548 | 195.650 | C10H10ClNO | 98.000 | Cl.Nc1ccccc1-c1ccco1 | 1g | 232329508
2-(2-Furyl)aniline hydrochloride | Combi-Blocks | 855948-13-9 | MFCD08445548 | 195.650 | C10H10ClNO | 98.000 | Cl.Nc1ccccc1-c1ccco1 | 1g | 232329508
Chem-Impex International, Inc. o-Carboxyphenylacetic acid cyclic anhydride | MFCD00006894 | 5G
o-Carboxyphenylacetic acid cyclic anhydride, MFCD00006894, 5G
eMolecules 201733-56-4 | Bis(neopentyl glycolato)diboron | Combi-Blocks | MFCD02093062 | 225.89 | C10H20B2O4 | 98 | CC1(C)COB(OC1)B1OCC(C)(C)CO1 | 500g | 296389764
ChemScene | Benzyl (cyanomethyl)carbamate | 250mg | 714110184 | CS-0129441 | 3589-41-1 | MFCD00033175 | 190.202 | C10H10N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 2-Amino-5-phenyl-3-furonitrile | 14742-32-6 | 1G | Purity: 95%
Combi-Blocks | 2-Amino-5-phenyl-3-furonitrile | 1G | 14742-32-6 | MFCD00463472
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 39079-62-4 | Chromone-3-carboxylic acid | Combi-Blocks | MFCD00017338 | 190.154 | C10H6O4 | 98.000 | OC(=O)c1coc2ccccc2c1=O | 5g | 388721422
Chromone-3-carboxylic acid | Combi-Blocks | 39079-62-4 | MFCD00017338 | 190.154 | C10H6O4 | 98.000 | OC(=O)c1coc2ccccc2c1=O | 5g | 388721422
eMolecules 5006-45-1 | 6-Chlorochromone-2-carboxylic acid | Chem-Impex | MFCD00847039 | 224.600 | C10H5ClO4 | 99.000 | OC(=O)c1cc(=O)c2cc(Cl)ccc2o1 | 5g | 112770196
6-Chlorochromone-2-carboxylic acid | Chem-Impex | 5006-45-1 | MFCD00847039 | 224.600 | C10H5ClO4 | 99.000 | OC(=O)c1cc(=O)c2cc(Cl)ccc2o1 | 5g | 112770196
eMolecules 845457-55-8 | (3-METHYLBENZOFURAN-2-YL)BORONIC ACID | AstaTech | MFCD18383018 | 175.980 | C9H9BO3 | 95.000 | Cc1c(oc2ccccc12)B(O)O | 0.25g | 386413437
(3-METHYLBENZOFURAN-2-YL)BORONIC ACID | AstaTech | 845457-55-8 | MFCD18383018 | 175.980 | C9H9BO3 | 95.000 | Cc1c(oc2ccccc12)B(O)O | 0.25g | 386413437
eMolecules 14236-13-6 | ChemScene | 4-(Tert-butyl)phthalic acid | 100mg | 714104356 | CS-0180869 | MFCD00059045 | 222.24 | C12H14O4
Ambeed | O-(2-(Prop-2-yn-1-yloxy)ethyl)hydroxylamine | 100mg | 632810307 | A1159765 | 1895922-69-6 | MFCD29764324 | 115.132 | C5H9NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC HY-125833 5mg Medchemexpress, Alpha-Naphthoflavone CAS:604-59-1 Purity:>98%
Medchemexpress, HY-125833 5mg Alpha-Naphthoflavone CAS:604-59-1 Alpha-Naphthoflavone is a synthetic flavonoid, acts as a potent and competitive aromatase inhibitor with an IC50 and a Ki of 0.5 and 0.2 μM, respectively. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
eMolecules 7504-44-1 | 1,3-Thiazol-4-ylacetic acid | MFCD09991935 | 1g
Combi-Blocks | 1,3-Thiazol-4-ylacetic acid | 1g | 232319456 | QB-2727 | 97.000 | 7504-44-1 | MFCD09991935 | 143.160 | C5H5NO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 19814-75-6 | 9,9-Dimethyl-9H-xanthene | Ambeed | MFCD00134434 | 210.276 | C15H14O | 98.000 | CC1(C)c2ccccc2Oc2ccccc12 | 100g | 552725258
9,9-Dimethyl-9H-xanthene | Ambeed | 19814-75-6 | MFCD00134434 | 210.276 | C15H14O | 98.000 | CC1(C)c2ccccc2Oc2ccccc12 | 100g | 552725258
eMolecules 72798-32-4 | 6,8-Dichloro-3-cyanochromone | Chem-Impex | MFCD00192004 | 240.040 | C10H3Cl2NO2 | 98.000 | Clc1cc(Cl)c2occ(C#N)c(=O)c2c1 | 5g | 386900142
6,8-Dichloro-3-cyanochromone | Chem-Impex | 72798-32-4 | MFCD00192004 | 240.040 | C10H3Cl2NO2 | 98.000 | Clc1cc(Cl)c2occ(C#N)c(=O)c2c1 | 5g | 386900142
Chemscene ChemScene | 2-(6-Methoxypyridin-3-yl)acetic acid | 250MG | CS-0082326 | 0.98 | 902130-87-4| MFCD09924951 | 167.16
ChemScene | 2-(6-Methoxypyridin-3-yl)acetic acid | 250MG | CS-0082326 | 0.98 | 902130-87-4| MFCD09924951 | 167.16
Chem-Impex International, Inc. 3-Cyanochromone | MFCD00052604 | 25G
3-Cyanochromone, MFCD00052604, 25G